ChemNet > CAS > 20481-15-6 ethyl 4-chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate
20481-15-6 ethyl 4-chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate
상품명칭 |
ethyl 4-chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
분자식 |
C11H12ClN3O2 |
분자량 |
253.6849 |
InChI |
InChI=1/C11H12ClN3O2/c1-4-17-11(16)7-5-13-10-8(9(7)12)6(2)14-15(10)3/h5H,4H2,1-3H3 |
cas번호 |
20481-15-6 |
분자 구조 |
|
밀도 |
1.38g/cm3 |
녹는 점 |
89℃ |
비등점 |
356°C at 760 mmHg |
굴절 지수 |
1.62 |
인화점 |
169.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|